C25H22N6O4 — CID 24540560
N-[2-[2-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide (PubChem CID 24540560) has the molecular formula C25H22N6O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is N-[2-[2-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide.
| Compound Name | N-[2-[2-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 24540560 |
| Molecular Formula | C25H22N6O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-[2-[2-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)hydrazinyl]-2-oxoethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCC(=O)NNC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H22N6O4/c32-21(16-26-22(33)17-35-20-14-8-3-9-15-20)28-29-25(34)23-27-24(18-10-4-1-5-11-18)31(30-23)19-12-6-2-7-13-19/h1-15H,16-17H2,(H,26,33)(H,28,32)(H,29,34) |
| InChIKey | FHFPINWFSWAXKD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|