C10H10N4O2 — CID 135968921
N-hydroxy-5-methyl-2-phenyltriazole-4-carboxamide (PubChem CID 135968921) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is N-hydroxy-5-methyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-hydroxy-5-methyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 135968921 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-hydroxy-5-methyl-2-phenyltriazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)NO |
| InChI | InChI=1S/C10H10N4O2/c1-7-9(10(15)13-16)12-14(11-7)8-5-3-2-4-6-8/h2-6,16H,1H3,(H,13,15) |
| InChIKey | AKBBXLALPOWBPH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|