C19H20N4O4 — CID 17435427
5-methyl-2-phenyl-N-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide (PubChem CID 17435427) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5-methyl-2-phenyl-N-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 5-methyl-2-phenyl-N-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 17435427 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 5-methyl-2-phenyl-N-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1cc(NC(=O)c2nn(-c3ccccc3)nc2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N4O4/c1-12-17(22-23(21-12)14-8-6-5-7-9-14)19(24)20-13-10-15(25-2)18(27-4)16(11-13)26-3/h5-11H,1-4H3,(H,20,24) |
| InChIKey | UJKJFLHZYNERDX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |