C16H12Cl2N4O — CID 26085730
N-(3,4-dichlorophenyl)-5-methyl-2-phenyltriazole-4-carboxamide (PubChem CID 26085730) has the molecular formula C16H12Cl2N4O and a molecular weight of 347.21 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-methyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-5-methyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 26085730 |
| Molecular Formula | C16H12Cl2N4O |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-methyl-2-phenyltriazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N4O/c1-10-15(21-22(20-10)12-5-3-2-4-6-12)16(23)19-11-7-8-13(17)14(18)9-11/h2-9H,1H3,(H,19,23) |
| InChIKey | CXOYEGHUALBOSK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |