C17H16N6O2 — CID 33151610
N-[4-(carbamoylamino)phenyl]-5-methyl-2-phenyltriazole-4-carboxamide (PubChem CID 33151610) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-5-methyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-5-methyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 33151610 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-5-methyl-2-phenyltriazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)Nc1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C17H16N6O2/c1-11-15(22-23(21-11)14-5-3-2-4-6-14)16(24)19-12-7-9-13(10-8-12)20-17(18)25/h2-10H,1H3,(H,19,24)(H3,18,20,25) |
| InChIKey | SLBIYQKXTZIURL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |