C21H25N4O4P — CID 3827368
N-[4-(diethoxyphosphorylmethyl)phenyl]-5-methyl-2-phenyltriazole-4-carboxamide (PubChem CID 3827368) has the molecular formula C21H25N4O4P and a molecular weight of 428.43 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-5-methyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-5-methyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 3827368 |
| Molecular Formula | C21H25N4O4P |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-5-methyl-2-phenyltriazole-4-carboxamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)c2nn(-c3ccccc3)nc2C)cc1)OCC |
| InChI | InChI=1S/C21H25N4O4P/c1-4-28-30(27,29-5-2)15-17-11-13-18(14-12-17)22-21(26)20-16(3)23-25(24-20)19-9-7-6-8-10-19/h6-14H,4-5,15H2,1-3H3,(H,22,26) |
| InChIKey | SOFFTOAPMCAXEK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|