C23H18N4O3 — CID 9098208
N-(2-methoxydibenzofuran-3-yl)-5-methyl-2-phenyltriazole-4-carboxamide (PubChem CID 9098208) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-5-methyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-5-methyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 9098208 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-5-methyl-2-phenyltriazole-4-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1nn(-c3ccccc3)nc1C)oc1ccccc12 |
| InChI | InChI=1S/C23H18N4O3/c1-14-22(26-27(25-14)15-8-4-3-5-9-15)23(28)24-18-13-20-17(12-21(18)29-2)16-10-6-7-11-19(16)30-20/h3-13H,1-2H3,(H,24,28) |
| InChIKey | ZGATYTKAOPKJPM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |