C22H15FN4O3 — CID 46263215
1-(4-fluorophenyl)-N-(2-methoxydibenzofuran-3-yl)triazole-4-carboxamide (PubChem CID 46263215) has the molecular formula C22H15FN4O3 and a molecular weight of 402.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(2-methoxydibenzofuran-3-yl)triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-(2-methoxydibenzofuran-3-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 46263215 |
| Molecular Formula | C22H15FN4O3 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(2-methoxydibenzofuran-3-yl)triazole-4-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1cn(-c3ccc(F)cc3)nn1)oc1ccccc12 |
| InChI | InChI=1S/C22H15FN4O3/c1-29-21-10-16-15-4-2-3-5-19(15)30-20(16)11-17(21)24-22(28)18-12-27(26-25-18)14-8-6-13(23)7-9-14/h2-12H,1H3,(H,24,28) |
| InChIKey | NTVXABOWPVKGHT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |