C18H12F3N3O3 — CID 4766609
N-(2-methoxydibenzofuran-3-yl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 4766609) has the molecular formula C18H12F3N3O3 and a molecular weight of 375.31 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4766609 |
| Molecular Formula | C18H12F3N3O3 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1cc(C(F)(F)F)[nH]n1)oc1ccccc12 |
| InChI | InChI=1S/C18H12F3N3O3/c1-26-15-6-10-9-4-2-3-5-13(9)27-14(10)7-11(15)22-17(25)12-8-16(24-23-12)18(19,20)21/h2-8H,1H3,(H,22,25)(H,23,24) |
| InChIKey | PFYVWCUSRLVAEU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |