C22H14ClNO3S — CID 3922547
3-chloro-N-(2-methoxydibenzofuran-3-yl)-1-benzothiophene-2-carboxamide (PubChem CID 3922547) has the molecular formula C22H14ClNO3S and a molecular weight of 407.88 g/mol. Its IUPAC name is 3-chloro-N-(2-methoxydibenzofuran-3-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(2-methoxydibenzofuran-3-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3922547 |
| Molecular Formula | C22H14ClNO3S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 3-chloro-N-(2-methoxydibenzofuran-3-yl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc2c(cc1NC(=O)c1sc3ccccc3c1Cl)oc1ccccc12 |
| InChI | InChI=1S/C22H14ClNO3S/c1-26-18-10-14-12-6-2-4-8-16(12)27-17(14)11-15(18)24-22(25)21-20(23)13-7-3-5-9-19(13)28-21/h2-11H,1H3,(H,24,25) |
| InChIKey | GIIMXIHQVXQZDO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |