C24H15N7O2 — CID 25136488
5-(4-nitrophenyl)-10,12-diphenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 25136488) has the molecular formula C24H15N7O2 and a molecular weight of 433.43 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-10,12-diphenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 5-(4-nitrophenyl)-10,12-diphenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 25136488 |
| Molecular Formula | C24H15N7O2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 5-(4-nitrophenyl)-10,12-diphenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc3c4c(-c5ccccc5)nn(-c5ccccc5)c4ncn23)cc1 |
| InChI | InChI=1S/C24H15N7O2/c32-31(33)19-13-11-17(12-14-19)22-26-27-24-20-21(16-7-3-1-4-8-16)28-30(18-9-5-2-6-10-18)23(20)25-15-29(22)24/h1-15H |
| InChIKey | DJVTVFOOGLGLNF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|