C28H18N6 — CID 25136493
5-naphthalen-1-yl-10,12-diphenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 25136493) has the molecular formula C28H18N6 and a molecular weight of 438.49 g/mol. Its IUPAC name is 5-naphthalen-1-yl-10,12-diphenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 5-naphthalen-1-yl-10,12-diphenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 25136493 |
| Molecular Formula | C28H18N6 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 5-naphthalen-1-yl-10,12-diphenyl-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | c1ccc(-c2nn(-c3ccccc3)c3ncn4c(-c5cccc6ccccc56)nnc4c23)cc1 |
| InChI | InChI=1S/C28H18N6/c1-3-11-20(12-4-1)25-24-27(34(32-25)21-14-5-2-6-15-21)29-18-33-26(30-31-28(24)33)23-17-9-13-19-10-7-8-16-22(19)23/h1-18H |
| InChIKey | JGKKHJALUSJAGT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |