C20H14N4O3 — CID 127256525
5-(4-nitrophenoxy)-1,3-diphenyl-1,2,4-triazole (PubChem CID 127256525) has the molecular formula C20H14N4O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 5-(4-nitrophenoxy)-1,3-diphenyl-1,2,4-triazole.
| Compound Name | 5-(4-nitrophenoxy)-1,3-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 127256525 |
| Molecular Formula | C20H14N4O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 5-(4-nitrophenoxy)-1,3-diphenyl-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccc(Oc2nc(-c3ccccc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14N4O3/c25-24(26)17-11-13-18(14-12-17)27-20-21-19(15-7-3-1-4-8-15)22-23(20)16-9-5-2-6-10-16/h1-14H |
| InChIKey | LFWXHAJIXGDKOO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|