C17H11N5O3 — CID 167971445
4-(4-nitrophenoxy)-1-phenylpyrazolo[5,4-d]pyrimidine (PubChem CID 167971445) has the molecular formula C17H11N5O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 4-(4-nitrophenoxy)-1-phenylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-(4-nitrophenoxy)-1-phenylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 167971445 |
| Molecular Formula | C17H11N5O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-(4-nitrophenoxy)-1-phenylpyrazolo[5,4-d]pyrimidine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ncnc3c2cnn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H11N5O3/c23-22(24)13-6-8-14(9-7-13)25-17-15-10-20-21(16(15)18-11-19-17)12-4-2-1-3-5-12/h1-11H |
| InChIKey | FHIBRMLIHCCZHA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|