C19H10ClN5O2 — CID 71593660
2-chloro-5-nitro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene (PubChem CID 71593660) has the molecular formula C19H10ClN5O2 and a molecular weight of 375.78 g/mol. Its IUPAC name is 2-chloro-5-nitro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene.
| Compound Name | 2-chloro-5-nitro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene |
|---|---|
| PubChem CID | 71593660 |
| Molecular Formula | C19H10ClN5O2 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-chloro-5-nitro-14-phenyl-9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),2,4,6,8,10,12,15-octaene |
| SMILES | O=[N+]([O-])c1ccc2nc3c(cnc4c3cnn4-c3ccccc3)c(Cl)c2c1 |
| InChI | InChI=1S/C19H10ClN5O2/c20-17-13-8-12(25(26)27)6-7-16(13)23-18-14(17)9-21-19-15(18)10-22-24(19)11-4-2-1-3-5-11/h1-10H |
| InChIKey | JPYWPZNXCFLNTJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|