About 2-nitrophenanthridine
2-nitrophenanthridine (PubChem CID 15065495) has the molecular formula C13H8N2O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-nitrophenanthridine.
Molecular Properties
| Compound Name | 2-nitrophenanthridine |
| PubChem CID | 15065495 |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-nitrophenanthridine |
| SMILES | O=[N+]([O-])c1ccc2ncc3ccccc3c2c1 |
| InChI | InChI=1S/C13H8N2O2/c16-15(17)10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13/h1-8H |
| InChIKey | VNGBWZWREQUEMN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrophenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrophenanthridine?
The IUPAC name of 2-nitrophenanthridine (CID 15065495) is 2-nitrophenanthridine.
What is the SMILES notation for 2-nitrophenanthridine?
The canonical SMILES for 2-nitrophenanthridine is O=[N+]([O-])c1ccc2ncc3ccccc3c2c1.
What is the InChIKey of 2-nitrophenanthridine?
The InChIKey is VNGBWZWREQUEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2/c16-15(17)10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13/h1-8H.
What are the key properties of 2-nitrophenanthridine?
2-nitrophenanthridine has a molecular weight of 224.22 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrophenanthridine is sourced from PubChem (CID 15065495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).