About phenanthridine
phenanthridine (PubChem CID 9189) has the molecular formula C13H9N
and a molecular weight of 179.22 g/mol. Its IUPAC name is phenanthridine.
Molecular Properties
| Compound Name | phenanthridine |
| PubChem CID | 9189 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | phenanthridine |
| SMILES | c1ccc2c(c1)cnc1ccccc12 |
| InChI | InChI=1S/C13H9N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-9H |
| InChIKey | RDOWQLZANAYVLL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthridine?
The IUPAC name of phenanthridine (CID 9189) is phenanthridine.
What is the SMILES notation for phenanthridine?
The canonical SMILES for phenanthridine is c1ccc2c(c1)cnc1ccccc12.
What is the InChIKey of phenanthridine?
The InChIKey is RDOWQLZANAYVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-9H.
What are the key properties of phenanthridine?
phenanthridine has a molecular weight of 179.22 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthridine is sourced from PubChem (CID 9189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).