About phenanthridine;platinum(2+)
phenanthridine;platinum(2+) (PubChem CID 23616726) has the molecular formula C13H9NPt+2
and a molecular weight of 374.30 g/mol. Its IUPAC name is phenanthridine;platinum(2+).
Molecular Properties
| Compound Name | phenanthridine;platinum(2+) |
| PubChem CID | 23616726 |
| Molecular Formula | C13H9NPt+2 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | phenanthridine;platinum(2+) |
| SMILES | [Pt+2].c1ccc2c(c1)cnc1ccccc12 |
| InChI | InChI=1S/C13H9N.Pt/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13;/h1-9H;/q;+2 |
| InChIKey | NIBMMWAVCJVQEL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthridine;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthridine;platinum(2+)?
The IUPAC name of phenanthridine;platinum(2+) (CID 23616726) is phenanthridine;platinum(2+).
What is the SMILES notation for phenanthridine;platinum(2+)?
The canonical SMILES for phenanthridine;platinum(2+) is [Pt+2].c1ccc2c(c1)cnc1ccccc12.
What is the InChIKey of phenanthridine;platinum(2+)?
The InChIKey is NIBMMWAVCJVQEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.Pt/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13;/h1-9H;/q;+2.
What are the key properties of phenanthridine;platinum(2+)?
phenanthridine;platinum(2+) has a molecular weight of 374.30 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthridine;platinum(2+) is sourced from PubChem (CID 23616726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).