About phenanthridine;7H-purin-6-amine
phenanthridine;7H-purin-6-amine (PubChem CID 90006324) has the molecular formula C18H14N6
and a molecular weight of 314.35 g/mol. Its IUPAC name is phenanthridine;7H-purin-6-amine.
Molecular Properties
| Compound Name | phenanthridine;7H-purin-6-amine |
| PubChem CID | 90006324 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | phenanthridine;7H-purin-6-amine |
| SMILES | Nc1ncnc2nc[nH]c12.c1ccc2c(c1)cnc1ccccc12 |
| InChI | InChI=1S/C13H9N.C5H5N5/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13;6-4-3-5(9-1-7-3)10-2-8-4/h1-9H;1-2H,(H3,6,7,8,9,10) |
| InChIKey | LVJBJNQCFJRNJT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthridine;7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthridine;7H-purin-6-amine?
The IUPAC name of phenanthridine;7H-purin-6-amine (CID 90006324) is phenanthridine;7H-purin-6-amine.
What is the SMILES notation for phenanthridine;7H-purin-6-amine?
The canonical SMILES for phenanthridine;7H-purin-6-amine is Nc1ncnc2nc[nH]c12.c1ccc2c(c1)cnc1ccccc12.
What is the InChIKey of phenanthridine;7H-purin-6-amine?
The InChIKey is LVJBJNQCFJRNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C5H5N5/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13;6-4-3-5(9-1-7-3)10-2-8-4/h1-9H;1-2H,(H3,6,7,8,9,10).
What are the key properties of phenanthridine;7H-purin-6-amine?
phenanthridine;7H-purin-6-amine has a molecular weight of 314.35 g/mol, XLogP of 3.32, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthridine;7H-purin-6-amine is sourced from PubChem (CID 90006324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).