About 4-(4-aminophenyl)aniline;7H-purin-6-amine
4-(4-aminophenyl)aniline;7H-purin-6-amine (PubChem CID 160907606) has the molecular formula C17H17N7
and a molecular weight of 319.37 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;7H-purin-6-amine.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;7H-purin-6-amine |
| PubChem CID | 160907606 |
| Molecular Formula | C17H17N7 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-(4-aminophenyl)aniline;7H-purin-6-amine |
| SMILES | Nc1ccc(-c2ccc(N)cc2)cc1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H12N2.C5H5N5/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;6-4-3-5(9-1-7-3)10-2-8-4/h1-8H,13-14H2;1-2H,(H3,6,7,8,9,10) |
| InChIKey | SQIVFEUTWFAHDC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;7H-purin-6-amine?
The IUPAC name of 4-(4-aminophenyl)aniline;7H-purin-6-amine (CID 160907606) is 4-(4-aminophenyl)aniline;7H-purin-6-amine.
What is the SMILES notation for 4-(4-aminophenyl)aniline;7H-purin-6-amine?
The canonical SMILES for 4-(4-aminophenyl)aniline;7H-purin-6-amine is Nc1ccc(-c2ccc(N)cc2)cc1.Nc1ncnc2nc[nH]c12.
What is the InChIKey of 4-(4-aminophenyl)aniline;7H-purin-6-amine?
The InChIKey is SQIVFEUTWFAHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C5H5N5/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;6-4-3-5(9-1-7-3)10-2-8-4/h1-8H,13-14H2;1-2H,(H3,6,7,8,9,10).
What are the key properties of 4-(4-aminophenyl)aniline;7H-purin-6-amine?
4-(4-aminophenyl)aniline;7H-purin-6-amine has a molecular weight of 319.37 g/mol, XLogP of 2.45, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;7H-purin-6-amine is sourced from PubChem (CID 160907606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).