About 5-aminopyridine-3-carboxamide;7H-purin-6-amine
5-aminopyridine-3-carboxamide;7H-purin-6-amine (PubChem CID 22262480) has the molecular formula C11H12N8O
and a molecular weight of 272.27 g/mol. Its IUPAC name is 5-aminopyridine-3-carboxamide;7H-purin-6-amine.
Molecular Properties
| Compound Name | 5-aminopyridine-3-carboxamide;7H-purin-6-amine |
| PubChem CID | 22262480 |
| Molecular Formula | C11H12N8O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 5-aminopyridine-3-carboxamide;7H-purin-6-amine |
| SMILES | NC(=O)c1cncc(N)c1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C6H7N3O.C5H5N5/c7-5-1-4(6(8)10)2-9-3-5;6-4-3-5(9-1-7-3)10-2-8-4/h1-3H,7H2,(H2,8,10);1-2H,(H3,6,7,8,9,10) |
| InChIKey | QEPVBFQULFLPBF-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 162.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-aminopyridine-3-carboxamide;7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopyridine-3-carboxamide;7H-purin-6-amine?
The IUPAC name of 5-aminopyridine-3-carboxamide;7H-purin-6-amine (CID 22262480) is 5-aminopyridine-3-carboxamide;7H-purin-6-amine.
What is the SMILES notation for 5-aminopyridine-3-carboxamide;7H-purin-6-amine?
The canonical SMILES for 5-aminopyridine-3-carboxamide;7H-purin-6-amine is NC(=O)c1cncc(N)c1.Nc1ncnc2nc[nH]c12.
What is the InChIKey of 5-aminopyridine-3-carboxamide;7H-purin-6-amine?
The InChIKey is QEPVBFQULFLPBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O.C5H5N5/c7-5-1-4(6(8)10)2-9-3-5;6-4-3-5(9-1-7-3)10-2-8-4/h1-3H,7H2,(H2,8,10);1-2H,(H3,6,7,8,9,10).
What are the key properties of 5-aminopyridine-3-carboxamide;7H-purin-6-amine?
5-aminopyridine-3-carboxamide;7H-purin-6-amine has a molecular weight of 272.27 g/mol, XLogP of -0.30, 1 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopyridine-3-carboxamide;7H-purin-6-amine is sourced from PubChem (CID 22262480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).