C10H10N10O4S-2 — CID 23616791
bis(7H-purin-6-amine);sulfate (PubChem CID 23616791) has the molecular formula C10H10N10O4S-2 and a molecular weight of 366.32 g/mol. Its IUPAC name is bis(7H-purin-6-amine);sulfate.
| Compound Name | bis(7H-purin-6-amine);sulfate |
|---|---|
| PubChem CID | 23616791 |
| Molecular Formula | C10H10N10O4S-2 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | bis(7H-purin-6-amine);sulfate |
| SMILES | Nc1ncnc2nc[nH]c12.Nc1ncnc2nc[nH]c12.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C5H5N5.H2O4S/c2*6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4/h2*1-2H,(H3,6,7,8,9,10);(H2,1,2,3,4)/p-2 |
| InChIKey | LQXHSCOPYJCOMD-UHFFFAOYSA-L |
| XLogP | -1.47 |
| TPSA | 241.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|