C9H9N7OSe — CID 87994034
7H-purin-6-amine;1,3-selenazole-2-carboxamide (PubChem CID 87994034) has the molecular formula C9H9N7OSe and a molecular weight of 310.18 g/mol. Its IUPAC name is 7H-purin-6-amine;1,3-selenazole-2-carboxamide.
| Compound Name | 7H-purin-6-amine;1,3-selenazole-2-carboxamide |
|---|---|
| PubChem CID | 87994034 |
| Molecular Formula | C9H9N7OSe |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 7H-purin-6-amine;1,3-selenazole-2-carboxamide |
| SMILES | NC(=O)c1ncc[se]1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5.C4H4N2OSe/c6-4-3-5(9-1-7-3)10-2-8-4;5-3(7)4-6-1-2-8-4/h1-2H,(H3,6,7,8,9,10);1-2H,(H2,5,7) |
| InChIKey | AOSDQBKJKQJCRT-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|