C8H10N5NaO3 — CID 175024161
sodium;2-hydroxypropanoate;7H-purin-6-amine (PubChem CID 175024161) has the molecular formula C8H10N5NaO3 and a molecular weight of 247.19 g/mol. Its IUPAC name is sodium;2-hydroxypropanoate;7H-purin-6-amine.
| Compound Name | sodium;2-hydroxypropanoate;7H-purin-6-amine |
|---|---|
| PubChem CID | 175024161 |
| Molecular Formula | C8H10N5NaO3 |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | sodium;2-hydroxypropanoate;7H-purin-6-amine |
| SMILES | CC(O)C(=O)[O-].Nc1ncnc2nc[nH]c12.[Na+] |
| InChI | InChI=1S/C5H5N5.C3H6O3.Na/c6-4-3-5(9-1-7-3)10-2-8-4;1-2(4)3(5)6;/h1-2H,(H3,6,7,8,9,10);2,4H,1H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | IPGQKAWFLMFUPZ-UHFFFAOYSA-M |
| XLogP | -4.94 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | -4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |