C11H19N7O2 — CID 174798775
2,6-diaminohexanoic acid;7H-purin-6-amine (PubChem CID 174798775) has the molecular formula C11H19N7O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;7H-purin-6-amine.
| Compound Name | 2,6-diaminohexanoic acid;7H-purin-6-amine |
|---|---|
| PubChem CID | 174798775 |
| Molecular Formula | C11H19N7O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2,6-diaminohexanoic acid;7H-purin-6-amine |
| SMILES | NCCCCC(N)C(=O)O.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C6H14N2O2.C5H5N5/c7-4-2-1-3-5(8)6(9)10;6-4-3-5(9-1-7-3)10-2-8-4/h5H,1-4,7-8H2,(H,9,10);1-2H,(H3,6,7,8,9,10) |
| InChIKey | SFHDQGKFELTHCL-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 169.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|