C9H11N5O2 — CID 69404868
2-amino-4-(7H-purin-6-yl)butanoic acid (PubChem CID 69404868) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-amino-4-(7H-purin-6-yl)butanoic acid.
| Compound Name | 2-amino-4-(7H-purin-6-yl)butanoic acid |
|---|---|
| PubChem CID | 69404868 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-amino-4-(7H-purin-6-yl)butanoic acid |
| SMILES | NC(CCc1ncnc2nc[nH]c12)C(=O)O |
| InChI | InChI=1S/C9H11N5O2/c10-5(9(15)16)1-2-6-7-8(13-3-11-6)14-4-12-7/h3-5H,1-2,10H2,(H,15,16)(H,11,12,13,14) |
| InChIKey | VCOLSTQVXBJPIX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |