C11H19N7O5S — CID 87633644
2-amino-3-hydroxypropanoic acid;2-amino-3-sulfanylpropanoic acid;7H-purin-6-amine (PubChem CID 87633644) has the molecular formula C11H19N7O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is 2-amino-3-hydroxypropanoic acid;2-amino-3-sulfanylpropanoic acid;7H-purin-6-amine.
| Compound Name | 2-amino-3-hydroxypropanoic acid;2-amino-3-sulfanylpropanoic acid;7H-purin-6-amine |
|---|---|
| PubChem CID | 87633644 |
| Molecular Formula | C11H19N7O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-amino-3-hydroxypropanoic acid;2-amino-3-sulfanylpropanoic acid;7H-purin-6-amine |
| SMILES | NC(CO)C(=O)O.NC(CS)C(=O)O.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5.C3H7NO3.C3H7NO2S/c6-4-3-5(9-1-7-3)10-2-8-4;4-2(1-5)3(6)7;4-2(1-7)3(5)6/h1-2H,(H3,6,7,8,9,10);2,5H,1,4H2,(H,6,7);2,7H,1,4H2,(H,5,6) |
| InChIKey | KXCFUJPVVPIDLD-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 227.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|