About octadecanoic acid;7H-purin-6-amine
octadecanoic acid;7H-purin-6-amine (PubChem CID 141436047) has the molecular formula C23H41N5O2
and a molecular weight of 419.61 g/mol. Its IUPAC name is octadecanoic acid;7H-purin-6-amine.
Molecular Properties
| Compound Name | octadecanoic acid;7H-purin-6-amine |
| PubChem CID | 141436047 |
| Molecular Formula | C23H41N5O2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.33 |
| IUPAC Name | octadecanoic acid;7H-purin-6-amine |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C18H36O2.C5H5N5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-4-3-5(9-1-7-3)10-2-8-4/h2-17H2,1H3,(H,19,20);1-2H,(H3,6,7,8,9,10) |
| InChIKey | SXXADMPCWMTOKW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanoic acid;7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanoic acid;7H-purin-6-amine?
The IUPAC name of octadecanoic acid;7H-purin-6-amine (CID 141436047) is octadecanoic acid;7H-purin-6-amine.
What is the SMILES notation for octadecanoic acid;7H-purin-6-amine?
The canonical SMILES for octadecanoic acid;7H-purin-6-amine is CCCCCCCCCCCCCCCCCC(=O)O.Nc1ncnc2nc[nH]c12.
What is the InChIKey of octadecanoic acid;7H-purin-6-amine?
The InChIKey is SXXADMPCWMTOKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C5H5N5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-4-3-5(9-1-7-3)10-2-8-4/h2-17H2,1H3,(H,19,20);1-2H,(H3,6,7,8,9,10).
What are the key properties of octadecanoic acid;7H-purin-6-amine?
octadecanoic acid;7H-purin-6-amine has a molecular weight of 419.61 g/mol, XLogP of 6.27, 16 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoic acid;7H-purin-6-amine is sourced from PubChem (CID 141436047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).