C5H6ClN5 — CID 169432832
7H-purin-6-amine;hydrochloride (PubChem CID 169432832) has the molecular formula C5H6ClN5 and a molecular weight of 176.55 g/mol. Its IUPAC name is 7H-purin-6-amine;hydrochloride.
| Compound Name | 7H-purin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 169432832 |
| Molecular Formula | C5H6ClN5 |
| Molecular Weight | 176.55 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 7H-purin-6-amine;hydrochloride |
| SMILES | Cl.N[13c]1n[13cH]n[13c]2n[13cH][nH][13c]12 |
| InChI | InChI=1S/C5H5N5.ClH/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H3,6,7,8,9,10);1H/i1+1,2+1,3+1,4+1,5+1; |
| InChIKey | UQVDQSWZQXDUJB-JFGXUQBHSA-N |
| XLogP | 0.36 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.55 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |