C13H19N9O — CID 159357752
methane;2-methyl-1,7-dihydropurin-6-one;7H-purin-6-amine (PubChem CID 159357752) has the molecular formula C13H19N9O and a molecular weight of 317.36 g/mol. Its IUPAC name is methane;2-methyl-1,7-dihydropurin-6-one;7H-purin-6-amine.
| Compound Name | methane;2-methyl-1,7-dihydropurin-6-one;7H-purin-6-amine |
|---|---|
| PubChem CID | 159357752 |
| Molecular Formula | C13H19N9O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | methane;2-methyl-1,7-dihydropurin-6-one;7H-purin-6-amine |
| SMILES | C.C.Cc1nc2nc[nH]c2c(=O)[nH]1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C6H6N4O.C5H5N5.2CH4/c1-3-9-5-4(6(11)10-3)7-2-8-5;6-4-3-5(9-1-7-3)10-2-8-4;;/h2H,1H3,(H2,7,8,9,10,11);1-2H,(H3,6,7,8,9,10);2*1H4 |
| InChIKey | LIDGQIIDPFKUIU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |