About methanol;7H-purin-6-amine
methanol;7H-purin-6-amine (PubChem CID 67194832) has the molecular formula C6H9N5O
and a molecular weight of 167.17 g/mol. Its IUPAC name is methanol;7H-purin-6-amine.
Molecular Properties
| Compound Name | methanol;7H-purin-6-amine |
| PubChem CID | 67194832 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | methanol;7H-purin-6-amine |
| SMILES | CO.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5.CH4O/c6-4-3-5(9-1-7-3)10-2-8-4;1-2/h1-2H,(H3,6,7,8,9,10);2H,1H3 |
| InChIKey | GHJGLRJYQPJYCO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methanol;7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;7H-purin-6-amine?
The IUPAC name of methanol;7H-purin-6-amine (CID 67194832) is methanol;7H-purin-6-amine.
What is the SMILES notation for methanol;7H-purin-6-amine?
The canonical SMILES for methanol;7H-purin-6-amine is CO.Nc1ncnc2nc[nH]c12.
What is the InChIKey of methanol;7H-purin-6-amine?
The InChIKey is GHJGLRJYQPJYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5.CH4O/c6-4-3-5(9-1-7-3)10-2-8-4;1-2/h1-2H,(H3,6,7,8,9,10);2H,1H3.
What are the key properties of methanol;7H-purin-6-amine?
methanol;7H-purin-6-amine has a molecular weight of 167.17 g/mol, XLogP of -0.46, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;7H-purin-6-amine is sourced from PubChem (CID 67194832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).