C11H20N6O3 — CID 176998987
5-aminooxan-3-ol;methanol;7H-purin-6-amine (PubChem CID 176998987) has the molecular formula C11H20N6O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-aminooxan-3-ol;methanol;7H-purin-6-amine.
| Compound Name | 5-aminooxan-3-ol;methanol;7H-purin-6-amine |
|---|---|
| PubChem CID | 176998987 |
| Molecular Formula | C11H20N6O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-aminooxan-3-ol;methanol;7H-purin-6-amine |
| SMILES | CO.NC1COCC(O)C1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5.C5H11NO2.CH4O/c6-4-3-5(9-1-7-3)10-2-8-4;6-4-1-5(7)3-8-2-4;1-2/h1-2H,(H3,6,7,8,9,10);4-5,7H,1-3,6H2;2H,1H3 |
| InChIKey | RYODWWJQMUMEHM-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |