C9H14N6O2S — CID 174836451
2-(methylamino)-3-sulfanylpropanoic acid;7H-purin-6-amine (PubChem CID 174836451) has the molecular formula C9H14N6O2S and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-(methylamino)-3-sulfanylpropanoic acid;7H-purin-6-amine.
| Compound Name | 2-(methylamino)-3-sulfanylpropanoic acid;7H-purin-6-amine |
|---|---|
| PubChem CID | 174836451 |
| Molecular Formula | C9H14N6O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(methylamino)-3-sulfanylpropanoic acid;7H-purin-6-amine |
| SMILES | CNC(CS)C(=O)O.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H5N5.C4H9NO2S/c6-4-3-5(9-1-7-3)10-2-8-4;1-5-3(2-8)4(6)7/h1-2H,(H3,6,7,8,9,10);3,5,8H,2H2,1H3,(H,6,7) |
| InChIKey | NSBJBGWOEFHUIQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|