C10H9N7O4 — CID 71761480
2,4-dioxo-1H-pyrimidine-6-carboxylic acid;7H-purin-6-amine (PubChem CID 71761480) has the molecular formula C10H9N7O4 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;7H-purin-6-amine.
| Compound Name | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;7H-purin-6-amine |
|---|---|
| PubChem CID | 71761480 |
| Molecular Formula | C10H9N7O4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;7H-purin-6-amine |
| SMILES | Nc1ncnc2nc[nH]c12.O=C(O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N5.C5H4N2O4/c6-4-3-5(9-1-7-3)10-2-8-4;8-3-1-2(4(9)10)6-5(11)7-3/h1-2H,(H3,6,7,8,9,10);1H,(H,9,10)(H2,6,7,8,11) |
| InChIKey | LVMZGNWJDWSWOE-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 183.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |