About CID 67796265
CID 67796265 (PubChem CID 67796265) has the molecular formula C5H5N5Na
and a molecular weight of 158.12 g/mol.
Molecular Properties
| Compound Name | CID 67796265 |
| PubChem CID | 67796265 |
| Molecular Formula | C5H5N5Na |
| Molecular Weight | 158.12 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | — |
| SMILES | Nc1ncnc2nc[nH]c12.[Na] |
| InChI | InChI=1S/C5H5N5.Na/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H3,6,7,8,9,10); |
| InChIKey | WLUBBPFCDLPWOI-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.12 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 67796265 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67796265?
The IUPAC name of CID 67796265 (CID 67796265) is not available.
What is the SMILES notation for CID 67796265?
The canonical SMILES for CID 67796265 is Nc1ncnc2nc[nH]c12.[Na].
What is the InChIKey of CID 67796265?
The InChIKey is WLUBBPFCDLPWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5.Na/c6-4-3-5(9-1-7-3)10-2-8-4;/h1-2H,(H3,6,7,8,9,10);.
What are the key properties of CID 67796265?
CID 67796265 has a molecular weight of 158.12 g/mol, XLogP of -0.45, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67796265 is sourced from PubChem (CID 67796265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).