C12H12N6O — CID 66705736
benzamide;7H-purin-6-amine (PubChem CID 66705736) has the molecular formula C12H12N6O and a molecular weight of 256.27 g/mol. Its IUPAC name is benzamide;7H-purin-6-amine.
| Compound Name | benzamide;7H-purin-6-amine |
|---|---|
| PubChem CID | 66705736 |
| Molecular Formula | C12H12N6O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | benzamide;7H-purin-6-amine |
| SMILES | NC(=O)c1ccccc1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C7H7NO.C5H5N5/c8-7(9)6-4-2-1-3-5-6;6-4-3-5(9-1-7-3)10-2-8-4/h1-5H,(H2,8,9);1-2H,(H3,6,7,8,9,10) |
| InChIKey | WLBKIIPHHWZKMR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |