C11H13N7O6P2+2 — CID 162030735
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;7H-purin-6-amine;pyridine-3-carboxamide (PubChem CID 162030735) has the molecular formula C11H13N7O6P2+2 and a molecular weight of 401.22 g/mol. Its IUPAC name is hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;7H-purin-6-amine;pyridine-3-carboxamide.
| Compound Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;7H-purin-6-amine;pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162030735 |
| Molecular Formula | C11H13N7O6P2+2 |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;7H-purin-6-amine;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.Nc1ncnc2nc[nH]c12.O=[P+](O)O[P+](=O)O |
| InChI | InChI=1S/C6H6N2O.C5H5N5.O5P2/c7-6(9)5-2-1-3-8-4-5;6-4-3-5(9-1-7-3)10-2-8-4;1-6(2)5-7(3)4/h1-4H,(H2,7,9);1-2H,(H3,6,7,8,9,10);/p+2 |
| InChIKey | XBFCPBGNSFKDSM-UHFFFAOYSA-P |
| XLogP | 0.42 |
| TPSA | 220.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|