About 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide
3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide (PubChem CID 70618273) has the molecular formula C15H17N7O4
and a molecular weight of 359.35 g/mol. Its IUPAC name is 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide |
| PubChem CID | 70618273 |
| Molecular Formula | C15H17N7O4 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.O=C(O)CC(O)CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C9H11N5O3.C6H6N2O/c15-5(1-6(16)17)2-10-8-7-9(12-3-11-7)14-4-13-8;7-6(9)5-2-1-3-8-4-5/h3-5,15H,1-2H2,(H,16,17)(H2,10,11,12,13,14);1-4H,(H2,7,9) |
| InChIKey | NKXYQYUYJMQGII-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 180.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide?
The IUPAC name of 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide (CID 70618273) is 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide.
What is the SMILES notation for 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide?
The canonical SMILES for 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide is NC(=O)c1cccnc1.O=C(O)CC(O)CNc1ncnc2nc[nH]c12.
What is the InChIKey of 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide?
The InChIKey is NKXYQYUYJMQGII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O3.C6H6N2O/c15-5(1-6(16)17)2-10-8-7-9(12-3-11-7)14-4-13-8;7-6(9)5-2-1-3-8-4-5/h3-5,15H,1-2H2,(H,16,17)(H2,10,11,12,13,14);1-4H,(H2,7,9).
What are the key properties of 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide?
3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide has a molecular weight of 359.35 g/mol, XLogP of -0.22, 6 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-(7H-purin-6-ylamino)butanoic acid;pyridine-3-carboxamide is sourced from PubChem (CID 70618273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).