C16H17N5O3 — CID 131713011
1-[4-[2-hydroxy-3-(7H-purin-6-ylamino)propoxy]phenyl]ethanone (PubChem CID 131713011) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-(7H-purin-6-ylamino)propoxy]phenyl]ethanone.
| Compound Name | 1-[4-[2-hydroxy-3-(7H-purin-6-ylamino)propoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 131713011 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[4-[2-hydroxy-3-(7H-purin-6-ylamino)propoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCC(O)CNc2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C16H17N5O3/c1-10(22)11-2-4-13(5-3-11)24-7-12(23)6-17-15-14-16(19-8-18-14)21-9-20-15/h2-5,8-9,12,23H,6-7H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | NTPCRIKXNNRJFV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |