C10H16N6 — CID 62664479
N'-propan-2-yl-N-(7H-purin-6-yl)ethane-1,2-diamine (PubChem CID 62664479) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is N'-propan-2-yl-N-(7H-purin-6-yl)ethane-1,2-diamine.
| Compound Name | N'-propan-2-yl-N-(7H-purin-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62664479 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N'-propan-2-yl-N-(7H-purin-6-yl)ethane-1,2-diamine |
| SMILES | CC(C)NCCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C10H16N6/c1-7(2)11-3-4-12-9-8-10(14-5-13-8)16-6-15-9/h5-7,11H,3-4H2,1-2H3,(H2,12,13,14,15,16) |
| InChIKey | JVQOLSAXCWWTMU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|