C7H7F2N5 — CID 79098846
N-(2,2-difluoroethyl)-7H-purin-6-amine (PubChem CID 79098846) has the molecular formula C7H7F2N5 and a molecular weight of 199.16 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-7H-purin-6-amine.
| Compound Name | N-(2,2-difluoroethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 79098846 |
| Molecular Formula | C7H7F2N5 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | N-(2,2-difluoroethyl)-7H-purin-6-amine |
| SMILES | FC(F)CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C7H7F2N5/c8-4(9)1-10-6-5-7(12-2-11-5)14-3-13-6/h2-4H,1H2,(H2,10,11,12,13,14) |
| InChIKey | KPMDMRXIKIEBDT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |