C13H21N7 — CID 133301517
N-[2-(4-methylpiperazin-1-yl)propyl]-7H-purin-6-amine (PubChem CID 133301517) has the molecular formula C13H21N7 and a molecular weight of 275.36 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)propyl]-7H-purin-6-amine.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)propyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 133301517 |
| Molecular Formula | C13H21N7 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)propyl]-7H-purin-6-amine |
| SMILES | CC(CNc1ncnc2nc[nH]c12)N1CCN(C)CC1 |
| InChI | InChI=1S/C13H21N7/c1-10(20-5-3-19(2)4-6-20)7-14-12-11-13(16-8-15-11)18-9-17-12/h8-10H,3-7H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | XILQQGIUYGHTMD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |