C17H19FN6O — CID 94145816
N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-7H-purin-6-amine (PubChem CID 94145816) has the molecular formula C17H19FN6O and a molecular weight of 342.38 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-7H-purin-6-amine.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 94145816 |
| Molecular Formula | C17H19FN6O |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-7H-purin-6-amine |
| SMILES | Fc1ccc([C@H](CNc2ncnc3nc[nH]c23)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H19FN6O/c18-13-3-1-12(2-4-13)14(24-5-7-25-8-6-24)9-19-16-15-17(21-10-20-15)23-11-22-16/h1-4,10-11,14H,5-9H2,(H2,19,20,21,22,23)/t14-/m0/s1 |
| InChIKey | NKIKPSJSKQJYDN-AWEZNQCLSA-N |
| XLogP | 1.98 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |