C16H14ClN7 — CID 146129006
N-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-7H-purin-6-amine (PubChem CID 146129006) has the molecular formula C16H14ClN7 and a molecular weight of 339.79 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-7H-purin-6-amine.
| Compound Name | N-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 146129006 |
| Molecular Formula | C16H14ClN7 |
| Molecular Weight | 339.79 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-pyrazol-1-ylethyl]-7H-purin-6-amine |
| SMILES | Clc1ccc(C(CNc2ncnc3nc[nH]c23)n2cccn2)cc1 |
| InChI | InChI=1S/C16H14ClN7/c17-12-4-2-11(3-5-12)13(24-7-1-6-23-24)8-18-15-14-16(20-9-19-14)22-10-21-15/h1-7,9-10,13H,8H2,(H2,18,19,20,21,22) |
| InChIKey | DYPGLKFAHKIJDB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |