C9H9N7 — CID 79778598
N-(1-methylpyrazol-3-yl)-7H-purin-6-amine (PubChem CID 79778598) has the molecular formula C9H9N7 and a molecular weight of 215.22 g/mol. Its IUPAC name is N-(1-methylpyrazol-3-yl)-7H-purin-6-amine.
| Compound Name | N-(1-methylpyrazol-3-yl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 79778598 |
| Molecular Formula | C9H9N7 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | N-(1-methylpyrazol-3-yl)-7H-purin-6-amine |
| SMILES | Cn1ccc(Nc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C9H9N7/c1-16-3-2-6(15-16)14-9-7-8(11-4-10-7)12-5-13-9/h2-5H,1H3,(H2,10,11,12,13,14,15) |
| InChIKey | VELIDBRRJAYMFY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |