C12H10ClN5O2 — CID 69243386
5-chloro-2-[(7H-purin-6-ylamino)methyl]benzene-1,3-diol (PubChem CID 69243386) has the molecular formula C12H10ClN5O2 and a molecular weight of 291.70 g/mol. Its IUPAC name is 5-chloro-2-[(7H-purin-6-ylamino)methyl]benzene-1,3-diol.
| Compound Name | 5-chloro-2-[(7H-purin-6-ylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 69243386 |
| Molecular Formula | C12H10ClN5O2 |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 5-chloro-2-[(7H-purin-6-ylamino)methyl]benzene-1,3-diol |
| SMILES | Oc1cc(Cl)cc(O)c1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H10ClN5O2/c13-6-1-8(19)7(9(20)2-6)3-14-11-10-12(16-4-15-10)18-5-17-11/h1-2,4-5,19-20H,3H2,(H2,14,15,16,17,18) |
| InChIKey | CGMDEMAWPKTWKA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|