C12H10BrN5O3 — CID 69240765
[3,5-dihydroxy-4-[(7H-purin-6-ylamino)methyl]phenyl] hypobromite (PubChem CID 69240765) has the molecular formula C12H10BrN5O3 and a molecular weight of 352.15 g/mol. Its IUPAC name is [3,5-dihydroxy-4-[(7H-purin-6-ylamino)methyl]phenyl] hypobromite.
| Compound Name | [3,5-dihydroxy-4-[(7H-purin-6-ylamino)methyl]phenyl] hypobromite |
|---|---|
| PubChem CID | 69240765 |
| Molecular Formula | C12H10BrN5O3 |
| Molecular Weight | 352.15 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | [3,5-dihydroxy-4-[(7H-purin-6-ylamino)methyl]phenyl] hypobromite |
| SMILES | Oc1cc(OBr)cc(O)c1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H10BrN5O3/c13-21-6-1-8(19)7(9(20)2-6)3-14-11-10-12(16-4-15-10)18-5-17-11/h1-2,4-5,19-20H,3H2,(H2,14,15,16,17,18) |
| InChIKey | SOJWHKBXDDNTAQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|