C13H13N5O3 — CID 123322677
4-methoxy-3-[(7H-purin-6-ylamino)methyl]benzene-1,2-diol (PubChem CID 123322677) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-methoxy-3-[(7H-purin-6-ylamino)methyl]benzene-1,2-diol.
| Compound Name | 4-methoxy-3-[(7H-purin-6-ylamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 123322677 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-methoxy-3-[(7H-purin-6-ylamino)methyl]benzene-1,2-diol |
| SMILES | COc1ccc(O)c(O)c1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C13H13N5O3/c1-21-9-3-2-8(19)11(20)7(9)4-14-12-10-13(16-5-15-10)18-6-17-12/h2-3,5-6,19-20H,4H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | LWUMHUDWIBNLGB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|