C12H11N5O2 — CID 69242422
2-[(7H-purin-6-ylamino)methyl]benzene-1,4-diol (PubChem CID 69242422) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[(7H-purin-6-ylamino)methyl]benzene-1,4-diol.
| Compound Name | 2-[(7H-purin-6-ylamino)methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 69242422 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-[(7H-purin-6-ylamino)methyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C12H11N5O2/c18-8-1-2-9(19)7(3-8)4-13-11-10-12(15-5-14-10)17-6-16-11/h1-3,5-6,18-19H,4H2,(H2,13,14,15,16,17) |
| InChIKey | KLAFRFHICUEWKS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|