C13H14ClN5O4S — CID 175873135
4-chloro-2-[(7H-purin-6-ylamino)methyl]phenol;methanesulfonic acid (PubChem CID 175873135) has the molecular formula C13H14ClN5O4S and a molecular weight of 371.81 g/mol. Its IUPAC name is 4-chloro-2-[(7H-purin-6-ylamino)methyl]phenol;methanesulfonic acid.
| Compound Name | 4-chloro-2-[(7H-purin-6-ylamino)methyl]phenol;methanesulfonic acid |
|---|---|
| PubChem CID | 175873135 |
| Molecular Formula | C13H14ClN5O4S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 4-chloro-2-[(7H-purin-6-ylamino)methyl]phenol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Oc1ccc(Cl)cc1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H10ClN5O.CH4O3S/c13-8-1-2-9(19)7(3-8)4-14-11-10-12(16-5-15-10)18-6-17-11;1-5(2,3)4/h1-3,5-6,19H,4H2,(H2,14,15,16,17,18);1H3,(H,2,3,4) |
| InChIKey | IFKPBLOZPJLYBY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|